56576-86-4 Usage
Uses
Used in Pharmaceutical Industry:
Chloroacetyl-L-glutamic acid is used as a building block for the synthesis of pharmaceutical compounds, contributing to the development of new drugs with enhanced efficacy and targeted action.
Used in Cancer Treatment:
Chloroacetyl-L-glutamic acid is used as a potential chemotherapy agent, exhibiting its potential to inhibit the growth and proliferation of cancer cells, thereby offering a therapeutic option for various types of cancer.
Used in Enzyme Inhibition:
Chloroacetyl-L-glutamic acid is used as an enzyme inhibitor, targeting specific enzymes involved in various biological processes, which can be beneficial in treating certain diseases and conditions.
Used in Drug Delivery Systems:
Chloroacetyl-L-glutamic acid is used to promote drug delivery and improve the bioavailability of pharmaceuticals, enhancing the overall effectiveness and therapeutic outcomes of drug treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 56576-86-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,5,7 and 6 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 56576-86:
(7*5)+(6*6)+(5*5)+(4*7)+(3*6)+(2*8)+(1*6)=164
164 % 10 = 4
So 56576-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H10ClNO5/c8-3-5(10)9-4(7(13)14)1-2-6(11)12/h4H,1-3H2,(H,9,10)(H,11,12)(H,13,14)/t4-/m0/s1
