5664-51-7 Usage
Description
2-(4-Amino-benzenesulfonylamino)-thiazole-5-carboxylic acid, commonly referred to as ABTA, is a heterocyclic compound characterized by the presence of a thiazole ring. It serves as a crucial intermediate in the synthesis of pharmaceuticals and agrochemicals, and has shown antitumor properties in preclinical studies. ABTA's potential to target cancer cells makes it a valuable building block in the development of novel drugs, and its versatility in creating new chemical entities with diverse biological activities underscores its significance in medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Industry:
2-(4-Amino-benzenesulfonylamino)-thiazole-5-carboxylic acid is used as a key intermediate for the synthesis of various pharmaceuticals, leveraging its antitumor activity and its role in creating new chemical entities with therapeutic potential.
Used in Agrochemical Industry:
ABTA is utilized as a building block in the development of agrochemicals, where its chemical properties contribute to the creation of new compounds with applications in agriculture for pest control and crop protection.
Used in Medicinal Chemistry Research:
2-(4-Amino-benzenesulfonylamino)-thiazole-5-carboxylic acid is employed as a versatile molecule in medicinal chemistry for the exploration of its wide range of biological activities, which can lead to the discovery of new drugs and therapeutic agents.
Used in Drug Development:
ABTA is used as a component in drug development processes, where its potential for targeting cancer cells is harnessed to create more effective treatments for various types of cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 5664-51-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,6 and 4 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5664-51:
(6*5)+(5*6)+(4*6)+(3*4)+(2*5)+(1*1)=107
107 % 10 = 7
So 5664-51-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H14N2O2S/c1-2-22-16-10-12(7-8-15(16)21)9-13(11-19)18-20-14-5-3-4-6-17(14)23-18/h3-10,20H,2H2,1H3/b12-9+,18-13+