56682-07-6 Usage
Uses
Used in Organic Synthesis:
2-Amino-5-nitro-4-methyl-1,3-thiazole is utilized as a building block in organic synthesis for the creation of various pharmaceuticals and agrochemicals. Its unique structure allows for the development of a wide range of chemical compounds with diverse applications.
Used in Pharmaceutical Research:
In pharmaceutical research, 2-Amino-5-nitro-4-methyl-1,3-thiazole serves as an intermediate for the synthesis of new drugs. Its presence in the molecular structure can contribute to the therapeutic properties of the final pharmaceutical product.
Used in Chemical Manufacturing:
2-Amino-5-nitro-4-methyl-1,3-thiazole is also employed as an intermediate in the manufacture of other chemicals, playing a crucial role in the production process of various chemical substances.
Used in Laboratory Research:
2-Amino-5-nitro-4-methyl-1,3-thiazole is used as a reagent in organic reactions within laboratory research. Its participation in these reactions can lead to the discovery of new chemical compounds and insights into chemical behavior.
Used in Different Industries:
Depending on the specific context and application, 2-Amino-5-nitro-4-methyl-1,3-thiazole may have varying uses across different industries, such as the chemical, pharmaceutical, and agricultural sectors, where its unique properties can be leveraged for specific purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 56682-07-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,6,8 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 56682-07:
(7*5)+(6*6)+(5*6)+(4*8)+(3*2)+(2*0)+(1*7)=146
146 % 10 = 6
So 56682-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3O2S/c1-2-3(7(8)9)10-4(5)6-2/h1H3,(H2,5,6)
56682-07-6Relevant academic research and scientific papers
Nitrothiazolyl-monoazo-2,2,4-trimethyl-1,2,3,4-tetrahydroquinoline compounds for polyester
-
, (2008/06/13)
A monoazo compound of the formula, STR1 wherein X is hydrogen atom or lower alkyl group; Z is hydrogen atom, halogen atom, alkyl group, acylamino group, benzoylamino group or alkylsulfonylamino group; R1, R2, R3 and R4 independently are hydrogen atom or alkyl group, provided that R1, R2, R3 and R4 cannot simultaneously be hydrogen atoms; and R5 is hydrogen atom, alkyl group, substituted alkyl group, alkenyl group, cycloalkyl group, aralkyl group or phenyl group.
