56709-74-1 Usage
Uses
Used in Organic Synthesis:
3-Bromo-5-methoxy-2,6-dinitro-benzoic acid methyl ester is used as a building block in organic synthesis for the preparation of various pharmaceuticals and agrochemicals. Its unique structure allows for the creation of a diverse range of compounds with potential applications in these fields.
Used as a Corrosion Inhibitor:
3-BROMO-5-METHOXY-2,6-DINITRO-BENZOIC ACID METHYL ESTER is also known for its potential use as a corrosion inhibitor, which can be beneficial in protecting materials from the damaging effects of corrosion, thereby extending their lifespan and improving their performance.
Used in Antimicrobial Applications:
3-Bromo-5-methoxy-2,6-dinitro-benzoic acid methyl ester exhibits antibacterial and antifungal properties, making it a valuable component in the development of antimicrobial agents. These can be used in various industries, such as healthcare and agriculture, to combat microbial infections and contamination.
Used in Cancer Research:
Furthermore, 3-BROMO-5-METHOXY-2,6-DINITRO-BENZOIC ACID METHYL ESTER has been investigated for its potential use in the treatment of prostate cancer. Its incorporation into cancer research and therapeutic development could lead to the discovery of novel treatments and contribute to advancements in cancer care.
Check Digit Verification of cas no
The CAS Registry Mumber 56709-74-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,7,0 and 9 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 56709-74:
(7*5)+(6*6)+(5*7)+(4*0)+(3*9)+(2*7)+(1*4)=151
151 % 10 = 1
So 56709-74-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrN2O7/c1-18-5-3-4(10)7(11(14)15)6(9(13)19-2)8(5)12(16)17/h3H,1-2H3
56709-74-1Relevant academic research and scientific papers
PRODUCTS FROM NITRATION OF 3,5-SUBSTITUTED BENZOIC ACIDS
Nekhoroshev, A. A.,Sevbo, D. P.,Ginzburg, O. A.
, p. 313 - 317 (2007/10/02)
During the nitration of 3,5-substituted benzoic acids by a nitrating mixture one isomer is formed if one of the substituents is an acetylamino group.