56795-92-7 Usage
Uses
Used in Research Applications:
5-Benzyloxy-1H-pyrrolo(2,3-c)pyridine-3-carboxaldehyde, 97 is used as a research chemical for various scientific investigations. Its unique structure and properties make it a valuable compound for studying chemical reactions, synthesis, and other laboratory experiments.
Used in Laboratory Settings:
In laboratory environments, 5-Benzyloxy-1H-pyrrolo(2,3-c)pyridine-3-carboxaldehyde, 97 is used as a reagent or intermediate in the synthesis of other compounds. Its role in these processes is crucial for the development of new materials, pharmaceuticals, or other chemical products.
Used in Chemical Synthesis:
5-Benzyloxy-1H-pyrrolo(2,3-c)pyridine-3-carboxaldehyde, 97 is employed as a key component in the synthesis of complex organic molecules. Its presence in the reaction mixture can lead to the formation of new compounds with potential applications in various industries, such as pharmaceuticals, materials science, or agrochemicals.
Used in Material Science:
In the field of material science, 5-Benzyloxy-1H-pyrrolo(2,3-c)pyridine-3-carboxaldehyde, 97 is used as a building block for the development of new materials with unique properties. Its incorporation into the molecular structure of these materials can result in enhanced performance, such as improved stability, reactivity, or other desirable characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 56795-92-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,7,9 and 5 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 56795-92:
(7*5)+(6*6)+(5*7)+(4*9)+(3*5)+(2*9)+(1*2)=177
177 % 10 = 7
So 56795-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H12N2O2/c18-9-12-7-16-14-8-17-15(6-13(12)14)19-10-11-4-2-1-3-5-11/h1-9,16H,10H2
56795-92-7Relevant academic research and scientific papers
NOVEL INHIBITORS HEPATITIS C VIRUS REPLICATION
-
Page/Page column 287; 289, (2008/12/08)
The embodiments provide compounds of the general Formula I, as well as compositions, including pharmaceutical compositions, comprising a subject compound. The embodiments further provide treatment methods, including methods of treating a hepatitis C virus
