56843-80-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Chloro-2-phenylthieno[2,3-d]pyrimidine is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and reactivity allow for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 4-chloro-2-phenylthieno[2,3-d]pyrimidine serves as a starting material for the preparation of agrochemicals, such as pesticides and herbicides. Its ability to participate in various organic reactions enables the synthesis of novel agrochemicals with improved efficacy and selectivity.
Used in Electronic Materials Industry:
4-Chloro-2-phenylthieno[2,3-d]pyrimidine is utilized as a building block for the development of materials for electronic devices, such as organic semiconductors and optoelectronic materials. Its unique electronic properties and compatibility with various synthetic routes make it a promising candidate for the creation of advanced electronic materials.
Used in Organic Synthesis:
As a versatile intermediate in organic synthesis, 4-chloro-2-phenylthieno[2,3-d]pyrimidine is employed in the preparation of a wide range of organic compounds. Its ability to undergo nucleophilic substitution, cross-coupling, and cycloaddition reactions allows for the synthesis of diverse molecules with potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 56843-80-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,8,4 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 56843-80:
(7*5)+(6*6)+(5*8)+(4*4)+(3*3)+(2*8)+(1*0)=152
152 % 10 = 2
So 56843-80-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H7ClN2S/c13-10-9-6-7-16-12(9)15-11(14-10)8-4-2-1-3-5-8/h1-7H
56843-80-2Relevant academic research and scientific papers
Direct metallation of thienopyrimidines using a mixed lithium-cadmium base and antitumor activity of functionalized derivatives
Snegaroff, Katia,Lassagne, Frederic,Bentabed-Ababsa, Ghenia,Nassar, Ekhlass,Ely, Sidaty Cheikh Sid,Stephanie Hesse,Perspicace, Enrico,Derdour, Aicha,Mongin, Florence
experimental part, p. 4782 - 4788 (2009/12/08)
A series of thieno[2,3-d]- and thieno[3,2-d]pyrimidines have been easily synthesized using as key step a deproto-cadmiation-trapping sequence. Some of the compounds thus synthesized were screened for anticancer (cytotoxic) activities, and (S)-2-(6-iodo-2-
