56987-35-0 Usage
Uses
Used in Organic Synthesis:
3,3-DIBROMO-4,5,6,7-TETRAHYDRO-1H-AZEPIN-2(3H)-ONE is used as a key intermediate in organic synthesis for the development of novel chemical compounds. Its unique structure and reactivity make it a valuable building block for creating new molecules with potential applications in various industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3,3-DIBROMO-4,5,6,7-TETRAHYDRO-1H-AZEPIN-2(3H)-ONE is utilized as a starting material for the synthesis of new drug candidates. Its chemical properties and structural features offer opportunities for the design of innovative therapeutic agents with potential applications in treating various diseases and medical conditions.
Used in Material Science:
3,3-DIBROMO-4,5,6,7-TETRAHYDRO-1H-AZEPIN-2(3H)-ONE is employed in material science for the development of new materials with unique properties. Its chemical characteristics may contribute to the creation of advanced materials with potential applications in various fields, such as electronics, coatings, and polymers.
Used in Chemical Process Development:
In the chemical process industry, 3,3-DIBROMO-4,5,6,7-TETRAHYDRO-1H-AZEPIN-2(3H)-ONE is used as a catalyst or reactant in the development of new chemical processes. Its interesting chemical properties can facilitate the discovery of more efficient and sustainable methods for producing various chemicals and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 56987-35-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,9,8 and 7 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 56987-35:
(7*5)+(6*6)+(5*9)+(4*8)+(3*7)+(2*3)+(1*5)=180
180 % 10 = 0
So 56987-35-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H9Br2NO/c7-6(8)3-1-2-4-9-5(6)10/h1-4H2,(H,9,10)
