57196-63-1 Usage
General Description
2-CHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE is a chemical compound with the molecular formula C12H17ClO. It is a chlorinated ketone with a bulky pentamethylphenyl group attached to the carbon atom. 2-CHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE is commonly used as an intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and dyes. Its unique structure and reactivity make it a valuable building block for creating complex molecules in chemical synthesis. This chemical may have potential applications in the fields of medicinal chemistry and materials science. Its properties and uses make it an important compound in the study and development of new chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 57196-63-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,1,9 and 6 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 57196-63:
(7*5)+(6*7)+(5*1)+(4*9)+(3*6)+(2*6)+(1*3)=151
151 % 10 = 1
So 57196-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H17ClO/c1-7-8(2)10(4)13(12(15)6-14)11(5)9(7)3/h6H2,1-5H3
