572910-59-9 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloro-imidazo[1,2-b]pyridazine-2-carboxylic Acid, Methyl Ester is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
6-CHLORO-IMIDAZO[1,2-B]PYRIDAZINE-2-CARBOXYLIC ACID, METHYL ESTER serves as a valuable research tool in the field of organic chemistry, particularly in the study of heterocyclic compounds and their potential applications in various chemical reactions and processes.
Used in Material Science:
6-Chloro-imidazo[1,2-b]pyridazine-2-carboxylic Acid, Methyl Ester can be utilized in the development of new materials with specific properties, such as improved stability or reactivity, which can be beneficial in various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 572910-59-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,7,2,9,1 and 0 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 572910-59:
(8*5)+(7*7)+(6*2)+(5*9)+(4*1)+(3*0)+(2*5)+(1*9)=169
169 % 10 = 9
So 572910-59-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClN3O2/c1-14-8(13)5-4-12-7(10-5)3-2-6(9)11-12/h2-4H,1H3
572910-59-9Relevant academic research and scientific papers
IMIDAZOPYRIDAZINES USEFUL AS INHIBITORS OF THE PAR-2 SIGNALING PATHWAY
-
Paragraph 00231, (2015/04/15)
The present invention relates to compounds useful as inhibitors of the PAR-2 signaling pathway. The invention also relates to pharmaceutically acceptable compositions comprising the compounds of this invention; methods of treating of various diseases, dis
