57658-79-4 Usage
General Description
Imidazole, 1,4-dimethyl-5-nitro- is a chemical compound with the molecular formula C6H7N3O2. It is a derivative of imidazole, a five-membered heterocyclic aromatic ring containing two nitrogen atoms. The compound contains a nitro group, which is a functional group consisting of a nitrogen atom bonded to two oxygen atoms. Imidazole, 1,4-dimethyl-5-nitro- is used in organic synthesis, pharmaceuticals, and as a reagent in chemical reactions. It has potential applications in the development of new drugs and pharmaceutical products due to its unique chemical properties. Additionally, it may also have uses in biological research and as a building block in the production of other chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 57658-79-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,6,5 and 8 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 57658-79:
(7*5)+(6*7)+(5*6)+(4*5)+(3*8)+(2*7)+(1*9)=174
174 % 10 = 4
So 57658-79-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c1-4-5(8(9)10)7(2)3-6-4/h3H,1-2H3
