57658-79-4 Usage
Uses
Used in Organic Synthesis:
Imidazole, 1,4-dimethyl-5-nitrois utilized as a key intermediate in organic synthesis for the creation of various chemical compounds. Its unique structure and functional groups facilitate reactions that lead to the formation of a wide array of products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Imidazole, 1,4-dimethyl-5-nitroserves as a precursor in the development of new drugs and pharmaceutical products. Its chemical properties allow it to be modified and incorporated into medicinal compounds that target specific biological pathways or conditions.
Used as a Reagent in Chemical Reactions:
Imidazole, 1,4-dimethyl-5-nitrois employed as a reagent in various chemical reactions due to its reactive nature. It can participate in a range of processes, including substitution, addition, and elimination reactions, making it a versatile tool in the laboratory.
Used in Biological Research:
Imidazole, 1,4-dimethyl-5-nitroalso finds application in biological research, where it can be used to study the interactions of various biomolecules or to investigate the effects of chemical modifications on biological systems.
Used as a Building Block in Chemical Production:
Imidazole, 1,4-dimethyl-5-nitrocan be used as a building block in the production of other chemical compounds, contributing to the synthesis of complex molecules with specific functions or properties.
Check Digit Verification of cas no
The CAS Registry Mumber 57658-79-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,6,5 and 8 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 57658-79:
(7*5)+(6*7)+(5*6)+(4*5)+(3*8)+(2*7)+(1*9)=174
174 % 10 = 4
So 57658-79-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c1-4-5(8(9)10)7(2)3-6-4/h3H,1-2H3
