5789-21-9 Usage
Uses
Used in Analytical Biochemistry:
PTH-threonine is used as a key intermediate in the Edman degradation process for the identification and sequencing of amino acids in peptides and proteins. This process is essential for understanding the structure and function of proteins, which is crucial for various biological and medical applications.
Used in Protein Studies:
PTH-threonine is used as a tool in protein studies to analyze the sequence of amino acids in proteins. This information is vital for researchers to comprehend the proteins' roles in biological processes, their interactions with other molecules, and their potential as therapeutic targets.
Used in Peptide and Protein Identification:
PTH-threonine is used as a marker in the Edman degradation process to identify specific amino acids in peptide chains. This identification is crucial for determining the primary structure of peptides and proteins, which is essential for understanding their biological functions and potential applications in drug development and diagnostics.
Check Digit Verification of cas no
The CAS Registry Mumber 5789-21-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,7,8 and 9 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5789-21:
(6*5)+(5*7)+(4*8)+(3*9)+(2*2)+(1*1)=129
129 % 10 = 9
So 5789-21-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2S.C4H9NO3/c12-8-6-11(9(13)10-8)14-7-4-2-1-3-5-7;1-2(6)3(5)4(7)8/h1-5H,6H2,(H,10,12,13);2-3,6H,5H2,1H3,(H,7,8)
