5834-17-3 Usage
Description
3-Amino-2-methoxydibenzofuran is an organic compound characterized by the presence of an amino group and a methoxy group attached to a dibenzofuran ring. This unique structure endows it with specific chemical and physical properties, making it a versatile molecule for various applications.
Uses
Used in Polymer Synthesis:
3-Amino-2-methoxydibenzofuran is used as a monomer in the preparation of end functional poly(N-isopropylacrylamide) (PNIPAM). This polymer is known for its thermo-responsive properties, which allow it to undergo reversible phase transitions in response to temperature changes. The incorporation of 3-amino-2-methoxydibenzofuran into PNIPAM enhances its functional properties, making it suitable for various applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-amino-2-methoxydibenzofuran is used as a building block for the synthesis of various drug candidates. Its unique structure allows for the development of molecules with specific biological activities, making it a valuable component in the design of new therapeutic agents.
Used in Chemical Research:
3-amino-2-methoxydibenzofuran is also used in chemical research as a model compound to study the properties and reactivity of similar organic compounds. Its unique structure provides insights into the behavior of other molecules with similar functional groups, contributing to the advancement of organic chemistry.
Used in Material Science:
In the field of material science, 3-amino-2-methoxydibenzofuran is used to develop new materials with specific properties. Its incorporation into polymers and other materials can lead to the creation of materials with improved thermal stability, mechanical strength, and other desirable characteristics.
Overall, 3-amino-2-methoxydibenzofuran is a versatile compound with a wide range of applications across various industries, including pharmaceuticals, polymer synthesis, chemical research, and material science. Its unique structure and properties make it a valuable component in the development of new products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 5834-17-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,8,3 and 4 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5834-17:
(6*5)+(5*8)+(4*3)+(3*4)+(2*1)+(1*7)=103
103 % 10 = 3
So 5834-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H11NO2/c1-15-13-6-9-8-4-2-3-5-11(8)16-12(9)7-10(13)14/h2-7H,14H2,1H3