58364-97-9 Usage
Uses
Used in Pharmaceutical Industry:
5-hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid is used as an active pharmaceutical ingredient for its potential antifungal and antibacterial properties. Its unique structure and functional groups contribute to its effectiveness in combating various infections.
Used in Coordination Chemistry:
In the field of coordination chemistry, 5-hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid is used as a ligand for metal ions. Its ability to form stable complexes with metals makes it a valuable compound for research and applications in this area.
Used in Medicinal Chemistry:
5-hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid is utilized in medicinal chemistry for its potential to be developed into new drugs. Its unique structure and functional groups offer opportunities for the design and synthesis of novel therapeutic agents.
Used in Chemical Research:
5-hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid is also used in chemical research for studying the properties and reactions of pyrazole derivatives. Its carboxylic acid and hydroxyl groups provide a basis for exploring various chemical transformations and interactions.
Used in Material Science:
5-hydroxy-1-methyl-1H-pyrazole-3-carboxylic acid may find applications in material science, particularly in the development of new materials with specific properties. Its ability to form complexes with metal ions could be harnessed for creating materials with tailored characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 58364-97-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,3,6 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 58364-97:
(7*5)+(6*8)+(5*3)+(4*6)+(3*4)+(2*9)+(1*7)=159
159 % 10 = 9
So 58364-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O3/c1-7-4(8)2-3(6-7)5(9)10/h2,8H,1H3,(H,9,10)
58364-97-9Relevant academic research and scientific papers
TRISAZO-DYES WITH A PYRAZOLYL END GROUP AND THEIR USE IN INK-JET PRINTING
-
Page/Page column 21, (2008/12/05)
A compound of Formula (1) or a salt thereof: A-N=N-D-N=N-B-N=N-A' wherein A is an optionally substituted aryl, heteroaryl, non-aromatic heterocyclic or alkenyl group; D is an optionally substituted, optionally metallised 1,8-dihydroxynaphthalene group; B is an optionally substituted organic linking group; and A' is an optionally substituted pyrazolyl group which does not have an aromatic group as a substituent directly attached to either of the nitrogen atoms of the pyrazolyl ring. Also provided are compositions, inks, ink sets, substrates and cartridges all containing the compound or salt and printing processes using the compound or salt. The compounds and salts are especially useful for ink-jet printing.
