58481-10-0 Usage
Description
2-IODO-ISONICOTINIC ACID is a synthetic organic compound that belongs to the family of isonicotinic acids. It is characterized by its molecular formula C6H4INO2, which includes carbon, hydrogen, iodine, nitrogen, and oxygen atoms. The incorporation of an iodine atom in its structure increases the molecule's reactivity, making it valuable for certain chemical transformations. Due to its reactive nature, it is generally handled and stored under controlled conditions.
Uses
Used in Chemical Synthesis:
2-IODO-ISONICOTINIC ACID is used as a reagent in various chemical reactions for its ability to participate in a range of chemical transformations. Its iodine atom can be a key factor in these reactions, facilitating the synthesis of new compounds or intermediates.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-IODO-ISONICOTINIC ACID is used as a starting material or intermediate in the synthesis of potential drug candidates. Its reactivity and structural features make it a valuable component in the development of new medications.
Used in Analytical Chemistry:
2-IODO-ISONICOTINIC ACID is used as an analytical reagent in various analytical techniques, such as spectroscopy or chromatography, to identify or quantify specific compounds. Its unique properties can aid in the detection and analysis of target substances in complex mixtures.
Used in Material Science:
In the field of material science, 2-IODO-ISONICOTINIC ACID is used as a component in the development of new materials with specific properties. Its reactivity can contribute to the formation of novel materials with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 58481-10-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,4,8 and 1 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 58481-10:
(7*5)+(6*8)+(5*4)+(4*8)+(3*1)+(2*1)+(1*0)=140
140 % 10 = 0
So 58481-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H4INO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10)
58481-10-0Relevant articles and documents
HYDRAZONE DERIVATIVE
-
Page/Page column 54, (2010/11/08)
A compound represented by the following formula (I): wherein R1 represents hydrogen, aryl which may have a substituent, a saturated or unsaturated 5- to 7-membered heterocyclic group which may have a substituent, etc.; R2 represents hydrogen, aryl which may have a substituent, a saturated or unsaturated 5- to 7-membered heterocyclic group which may have a substituent, etc.; R3 represents hydrogen, etc.; Ar represents a divalent group derived from aromatic hydrocarbon, etc.; X represents a single bond, linear or branched alkylene having from 1 to 3 carbon atoms which may have a substituent, etc.; and G represents halogen, a saturated or unsaturated 5- or 6-membered cyclic hydrocarbon group which may have a substituent, a saturated or unsaturated 5- to 7-membered heterocyclic group which may have a substituent, etc., a salt thereof or a solvate thereof; and an agent for inhibiting aggregation and/or deposition of an amyloid protein or an amyloid-like protein, which comprises the compound, a salt thereof or a solvate thereof
Antitubercular agents. IV. Preparation of some derivatives on the nucleus of a substituted isonicotinic acid. II.
Celadnik,Palat,Novacek,Matuskova,Kubala,Pavlas
, p. 303 - 307 (2007/10/08)
-
