58888-49-6 Usage
Uses
Used in Chemical Production:
N,N-dimethylaniline is used as a key intermediate in the production of dyes, pesticides, pharmaceuticals, and rubber chemicals. Its aromatic nature and reactivity contribute to the synthesis of these products, enhancing their performance and utility.
Used as a Catalyst:
In various chemical reactions, N,N-dimethylaniline serves as an effective catalyst, facilitating the process and improving the yield of desired products. Its ability to participate in multiple reaction pathways makes it a valuable component in the synthesis of organic compounds.
Used as a Solvent:
Due to its solubility properties, N,N-dimethylaniline is utilized as a solvent in certain applications. It can dissolve a range of substances, making it useful in processes that require the dissolution of specific compounds for further reactions or purification.
Used in Synthesis of Organic Compounds:
N,N-dimethylaniline is employed as an intermediate in the synthesis of various organic compounds. Its presence in the reaction mixture can lead to the formation of new compounds with different properties and applications, expanding the scope of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 58888-49-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,8,8 and 8 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 58888-49:
(7*5)+(6*8)+(5*8)+(4*8)+(3*8)+(2*4)+(1*9)=196
196 % 10 = 6
So 58888-49-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N.H2O4S/c1-9(2)8-6-4-3-5-7-8;1-5(2,3)4/h3-7H,1-2H3;(H2,1,2,3,4)
