58897-74-8 Usage
Uses
Used in Polymer and Resin Production:
3-(4-Cyclohexylbenzoyl)acrylic acid is used as a monomer in the production of various polymers and resins. Its unique structure allows for the creation of materials with specific properties, such as enhanced stability, flexibility, or reactivity, depending on the desired application.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 3-(4-Cyclohexylbenzoyl)acrylic acid serves as a key intermediate in the synthesis of various drugs. Its reactivity and functional groups make it a valuable building block for the development of new medicinal compounds with potential therapeutic effects.
Used in Agrochemical Development:
3-(4-Cyclohexylbenzoyl)acrylic acid is also utilized in the agrochemical sector for the synthesis of pesticides, herbicides, and other crop protection agents. Its chemical properties enable the creation of effective and targeted agrochemicals that can improve crop yields and protect against pests and diseases.
Used as a Reagent in Organic Chemical Reactions:
3-(4-Cyclohexylbenzoyl)acrylic acid is employed as a reagent in various organic chemical reactions, particularly in the formation of carbon-carbon bonds. Its ability to participate in such reactions makes it a versatile tool in organic synthesis, allowing for the creation of complex molecules and compounds.
It is crucial to handle and store 3-(4-Cyclohexylbenzoyl)acrylic acid with care, as it can pose hazards if not properly managed. Proper safety measures and storage conditions are essential to ensure the safe use of 3-(4-CYCLOHEXYLBENZOYL)ACRYLIC ACID in research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 58897-74-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,8,9 and 7 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 58897-74:
(7*5)+(6*8)+(5*8)+(4*9)+(3*7)+(2*7)+(1*4)=198
198 % 10 = 8
So 58897-74-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H18O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h6-12H,1-5H2,(H,18,19)/b11-10+
58897-74-8Relevant academic research and scientific papers
COMPOUNDS AND METHODS OF THEIR USE
-
Page/Page column 83, (2020/05/19)
Provided are agents capable of binding the KIX domain of CBP or MED15 to inhibit the binding between SREBP1 and the KIX domain of MED15 or CBP. Also provided are compositions containing the agents and methods of their use.
Arylalkane, arylalkene and aryl azaalkane, medicaments containing said compounds and method for the production thereof
-
Page/Page column 63-64, (2010/11/27)
The present invention relates to compounds of general formula [in-line-formulae]R—Z1—Z2—Z3—R1, ??(I)[/in-line-formulae] wherein R, R1 and Z1 to Z3 are defined as in claim 1, the tautomers, the diastereomers, the enantiomers, the mixtures thereof and the salts thereof, particularly the physiologically acceptable salts thereof with inorganic or organic acids or bases, which have valuable pharmacological properties, particularly CGRP-antagonistic properties, pharmaceutical compositions containing these compounds, their use and processes for preparing them.
