5902-69-2 Usage
Uses
Used in Agrochemical Industry:
2,4,5-Trichlorophenyl chloroacetate is used as a precursor in the production of herbicides for controlling the growth of unwanted plants in agricultural fields. Its chemical properties make it a suitable building block for the synthesis of various herbicidal compounds.
Used in Pharmaceutical Industry:
2,4,5-Trichlorophenyl chloroacetate serves as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be incorporated into the development of new drugs with potential therapeutic applications.
Used in Dye Production:
2,4,5-Trichlorophenyl chloroacetate is utilized as a chemical intermediate in the production of dyes. Its reactivity and functional groups enable the creation of a wide range of colored compounds used in various industries, such as textiles and printing.
Used in Adhesive Manufacturing:
In the adhesive industry, 2,4,5-Trichlorophenyl chloroacetate is employed as a building block for the synthesis of adhesive components. Its properties contribute to the development of adhesives with specific bonding characteristics and performance requirements.
Safety Precautions:
Due to its toxic and hazardous nature, 2,4,5-Trichlorophenyl chloroacetate must be handled and stored with caution. It is essential to follow safety regulations and guidelines to minimize the risk of exposure and potential harm to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 5902-69-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,0 and 2 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5902-69:
(6*5)+(5*9)+(4*0)+(3*2)+(2*6)+(1*9)=102
102 % 10 = 2
So 5902-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H4Cl4O2/c9-3-8(13)14-7-2-5(11)4(10)1-6(7)12/h1-2H,3H2
