59129-52-1 Usage
Uses
Used in Chemical Synthesis:
5-Chloro-2-thiazolecarboxaldehyde is used as a key intermediate in the synthesis of various complex molecules and chemical compounds. Its unique structure enables it to be a valuable building block in the creation of new substances with potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-Chloro-2-thiazolecarboxaldehyde is used as a starting material for the development of new drugs. Its chemical properties allow it to be a potential candidate for the synthesis of therapeutic agents, contributing to the advancement of medicine.
Used in Research and Development:
5-Chloro-2-thiazolecarboxaldehyde is employed as a research compound in academic and industrial laboratories. Its reactivity and structural features make it an interesting subject for studying chemical reactions and exploring new synthetic pathways, which can lead to the discovery of novel compounds with potential applications in various fields.
Used in Material Science:
In the field of material science, 5-Chloro-2-thiazolecarboxaldehyde can be used as a component in the development of new materials with specific properties. Its incorporation into polymers or other materials can result in materials with improved characteristics, such as enhanced stability or reactivity, which can be beneficial in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 59129-52-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,1,2 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59129-52:
(7*5)+(6*9)+(5*1)+(4*2)+(3*9)+(2*5)+(1*2)=141
141 % 10 = 1
So 59129-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H2ClNOS/c5-3-1-6-4(2-7)8-3/h1-2H
59129-52-1Relevant academic research and scientific papers
HEPATITIS B VIRUS SURFACE ANTIGEN INHIBITOR
-
Paragraph 0217; 0222, (2020/01/22)
10-oxo-6,1-dihydrobenzo[e]pyrido[1,2-c][1,3]oxazine-9-carboxylic acid derivatives of formula (I) as hepatitis B surface antigen inhibitors or pharmaceutically acceptable salts thereof, and uses of a compound of formula (I) or pharmaceutically acceptable salts thereof and pharmaceutical compositions thereof in preparation of medicaments for treatment of viral hepatitis B.
NITROGEN-CONTAINING FIVE-MEMBERED HETEROCYCLIC COMPOUND
-
Page/Page column 125, (2010/03/02)
The present invention provides a compound represented by the formula (I): wherein each symbol is as defined in the specification, or a salt thereof. The compound of the present invention has a glucokinase activity, and is useful as a medicament such as an agent for the prophylaxis or treatment of diabetes, obesity and the like, and the like.
