59293-32-2 Usage
General Description
Tetrahydro-3-furancarboxylic acid hydrazide is a chemical compound commonly used in research and development laboratories. Its precise molecular structure, denoted by the molecular formula C5H9NO3, consists of a furan ring, which is a five-membered aromatic ring with oxygen, that's saturated with hydrogen atoms and linked with a carboxylic acid and a hydrazide group. Tetrahydro-3-furancarboxylic acid hydrazide is recognized for its important role in synthetic chemistry and medicinal chemistry due to its potential usage in the development of various bioactive molecules and pharmaceuticals. As a specific type of hydrazide compound, it also exhibits useful reactivity that allows it to perform as an effective building block in complex molecule synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 59293-32-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,2,9 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59293-32:
(7*5)+(6*9)+(5*2)+(4*9)+(3*3)+(2*3)+(1*2)=152
152 % 10 = 2
So 59293-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O2/c6-7-5(8)4-1-2-9-3-4/h4H,1-3,6H2,(H,7,8)
59293-32-2Relevant articles and documents
ANTIBIOTIC COMPOUNDS
-
Page/Page column 217; 218; 219, (2018/03/25)
The present invention relates to antibiotic compounds of formula (I), to compositions containing these compounds and to methods of treating bacterial diseases and infections using the compounds. The compounds find application in the treatment of infection with, and diseases caused by, Gram-positive and/or Gram-negative bacteria, and in particular in the treatment of infection with, and diseases caused by, Neisseria gonorrhoeae.
