5937-29-1 Usage
Tropane structure
The chemical compound contains a tropane structure, which is a core structure found in tropane alkaloids.
Derivative of tropane alkaloids
It is likely a derivative of tropane alkaloids, which are found in various plants such as deadly nightshade and henbane.
Benzoate group
The presence of a benzoate group suggests potential pharmaceutical or medicinal properties, as benzoates are often used in drug formulations and as preservatives.
Specific arrangement of carbons and hydroxy groups
The compound has a unique arrangement of carbons and hydroxy groups on the tropane structure, which may result in interesting effects on biological systems.
Potential for further research and development
Due to its unique structure and potential effects on biological systems, the compound may be a target for further research and development in the fields of medicine and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 5937-29-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,3 and 7 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5937-29:
(6*5)+(5*9)+(4*3)+(3*7)+(2*2)+(1*9)=121
121 % 10 = 1
So 5937-29-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H24NO4.HI/c1-19(2)13-9-10-14(19)16(18(21)22-3)15(11-13)23-17(20)12-7-5-4-6-8-12;/h4-8,13-16H,9-11H2,1-3H3;1H/q+1;/p-1/t13-,14+,15-,16+;/m0./s1
