596114-50-0 Usage
Uses
Used in Pharmaceutical Industry:
Pyrimidine, 2-chloro-5-(1-methylethyl)(9CI) is utilized as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to serve as a building block in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical sector, Pyrimidine, 2-chloro-5-(1-methylethyl)(9CI) is employed as a precursor in the production of pesticides and other crop protection agents. Its reactivity and potential to form stable compounds make it a valuable component in the creation of effective and targeted agrochemicals.
Used in Materials Science:
Pyrimidine, 2-chloro-5-(1-methylethyl)(9CI) also finds applications in materials science, where it can be used to develop new materials with specific properties. Its potential to form complexes or participate in various chemical reactions allows for the creation of materials with tailored characteristics for use in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 596114-50-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,9,6,1,1 and 4 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 596114-50:
(8*5)+(7*9)+(6*6)+(5*1)+(4*1)+(3*4)+(2*5)+(1*0)=170
170 % 10 = 0
So 596114-50-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H9ClN2/c1-5(2)6-3-9-7(8)10-4-6/h3-5H,1-2H3
596114-50-0Relevant academic research and scientific papers
HPPARS ACTIVATORS
-
Page/Page column 66, (2010/02/07)
Compounds of formula (1) or a pharmaceutically acceptable salt, solvate, acid isostere, or hydrolyzable ester thereof, are disclosed. Methods of making and using the compounds are also disclosed. In particular methods for treating diseases or conditions a
Pyri(mi)dyl-oxy-and -thio-benzoic acid derivatives useful as herbicides and plant growth regulants
-
, (2008/06/13)
New pyri(mi)dyl-oxy- or -thio-benzoic acid derivatives of the formula STR1 are taught which have herbicidal and plant growth regulating activity. In the formula Z can be Ch or N, X is oxygen or sulphur, A is oxygen, sulphur, a radical R5 --N=or a radical R6 O--N=and B is oxygen, sulphur, a radical STR2 with the proviso that at least one of the radicals R1, R2 or R3 represents alkyl or a part of a 3- to 6-membered fused carbocyclic ring.
