64171-58-0 Usage
Uses
Used in Pharmaceutical Industry:
2(1H)-Pyrimidinone, 5-(1-methylethyl)(9CI) is used as an intermediate in the synthesis of various drugs and pharmaceutical agents. Its unique chemical structure allows it to be incorporated into a wide range of therapeutic compounds, contributing to the development of new medications.
Used in Agrochemical Production:
Isobutylpyrimidinone has potential applications in the production of agrochemicals, where it can be used as a building block for the development of new pesticides, herbicides, and other agricultural chemicals. Its versatility in organic chemistry makes it a valuable component in the creation of these products.
Used in Specialty Chemicals:
2(1H)-Pyrimidinone, 5-(1-methylethyl)(9CI) is also utilized in the production of specialty chemicals, which are often used in niche applications such as research, development, and manufacturing processes. Its unique properties and reactivity make it a valuable asset in the synthesis of these specialized compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 64171-58-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,1,7 and 1 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 64171-58:
(7*6)+(6*4)+(5*1)+(4*7)+(3*1)+(2*5)+(1*8)=120
120 % 10 = 0
So 64171-58-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O/c1-5(2)6-3-8-7(10)9-4-6/h3-5H,1-2H3,(H,8,9,10)
64171-58-0Relevant academic research and scientific papers
HPPARS ACTIVATORS
-
Page/Page column 66, (2010/02/07)
Compounds of formula (1) or a pharmaceutically acceptable salt, solvate, acid isostere, or hydrolyzable ester thereof, are disclosed. Methods of making and using the compounds are also disclosed. In particular methods for treating diseases or conditions a
