59673-74-4 Usage
Uses
Used in Pharmaceutical Industry:
6-Amino-3-Hydroxy (1H) Indazole is used as a chemical intermediate for the synthesis of various therapeutic agents. Its high nitrogen content makes it a valuable component in the development of new drugs.
Used in Research and Development:
6-Amino-3-Hydroxy (1H) Indazole is used as a research compound for studying its chemical properties and potential applications in various fields, including medicinal chemistry and material science. Due to the limited documentation on its safety data and toxicity, it is primarily utilized in controlled research environments.
Check Digit Verification of cas no
The CAS Registry Mumber 59673-74-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,6,7 and 3 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 59673-74:
(7*5)+(6*9)+(5*6)+(4*7)+(3*3)+(2*7)+(1*4)=174
174 % 10 = 4
So 59673-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O/c8-4-1-2-5-6(3-4)9-10-7(5)11/h1-3H,8H2,(H2,9,10,11)