59899-89-7 Usage
Uses
Used in Pharmaceutical Research:
METHYL 2-(1,2-BENZISOXAZOL-3-YL)ACETATE is used as a building block in the development of new pharmaceuticals due to its unique chemical structure and potential biological activities, which can contribute to the creation of novel therapeutic agents.
Used in Agrochemical Development:
In the agrochemical industry, METHYL 2-(1,2-BENZISOXAZOL-3-YL)ACETATE is utilized as a key intermediate in the synthesis of various agrochemicals, potentially leading to the discovery of new pesticides or herbicides with improved efficacy and reduced environmental impact.
Used in Materials Science:
METHYL 2-(1,2-BENZISOXAZOL-3-YL)ACETATE is employed in materials science for the synthesis of advanced materials with specific properties, such as high thermal stability or unique electronic characteristics, which can be applied in various industrial applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, METHYL 2-(1,2-BENZISOXAZOL-3-YL)ACETATE is used as a subject of interest for research and development, given its potential pharmacological properties and the possibility of it being a precursor to compounds with therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 59899-89-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,8,9 and 9 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 59899-89:
(7*5)+(6*9)+(5*8)+(4*9)+(3*9)+(2*8)+(1*9)=217
217 % 10 = 7
So 59899-89-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO3/c1-13-10(12)6-8-7-4-2-3-5-9(7)14-11-8/h2-5H,6H2,1H3
59899-89-7Relevant academic research and scientific papers
Novel Base-induced Reactions of Substituted (1,2-Benzisoxazol-3-yl)acetates
Ueda, Shozo,Naruto, Shunsuke,Yoshida, Toyokichi,Sawayama, Tadahiro,Uno, Hitoshi
, p. 1013 - 1022 (2007/10/02)
The reactions of substituted (1,2-benzisoxazol-3-yl)acetates with strong bases are described.The esters (1) and (2) having electron-donating and dialkylamino substituents undergo novel ring transformations on treatment with NaH, ButOK, or MeONa
