59950-53-7 Usage
Uses
Used in Pharmaceutical Industry:
5-Aminopyrimidine-4-carboxylic acid is used as an intermediate in the synthesis of various pharmaceutical drugs. Its role in drug production is crucial due to its ability to be incorporated into the molecular structures of different medications.
Used in Agrochemical Industry:
APC is used as a key starting material in the production of herbicides and fungicides. Its chemical properties make it suitable for developing effective agents to protect crops from pests and diseases.
Used in Antiviral Applications:
5-Aminopyrimidine-4-carboxylic acid is used as a component in the development of antiviral agents. Its structure allows it to be modified and incorporated into antiviral medications, potentially inhibiting viral replication and reducing infection.
Used in Anticancer Applications:
APC is used as a building block in the synthesis of anticancer agents. Its potential role in cancer treatment is being studied, as it may contribute to the development of drugs that target and eliminate cancer cells.
Used in Research and Development:
5-Aminopyrimidine-4-carboxylic acid is used in research and development for exploring its potential therapeutic applications in treating various medical conditions, including cancer and viral infections. Its unique chemical properties make it a promising candidate for further investigation and innovation in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 59950-53-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,9,5 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 59950-53:
(7*5)+(6*9)+(5*9)+(4*5)+(3*0)+(2*5)+(1*3)=167
167 % 10 = 7
So 59950-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O2/c6-3-1-7-2-8-4(3)5(9)10/h1-2H,6H2,(H,9,10)
