28285-65-6 Usage
Uses
Used in Pharmaceutical Industry:
Pyrimido[5,4-d]pyrimidin-4-ol (8CI) is used as a pharmaceutical intermediate for the development of various therapeutic agents. Its unique structure and reactivity make it a valuable component in the synthesis of drugs targeting specific biological pathways or receptors.
Used in Organic Synthesis:
In the field of organic synthesis, Pyrimido[5,4-d]pyrimidin-4-ol (8CI) serves as a key building block for the creation of more complex organic molecules. Its distinct properties allow it to be incorporated into a wide range of chemical reactions, facilitating the synthesis of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 28285-65-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,8,2,8 and 5 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 28285-65:
(7*2)+(6*8)+(5*2)+(4*8)+(3*5)+(2*6)+(1*5)=136
136 % 10 = 6
So 28285-65-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O/c11-6-5-4(8-3-10-6)1-7-2-9-5/h1-3H,(H,8,10,11)
