60034-28-8 Usage
General Description
Crotonyl isothiocyanate, also known as allyl isothiocyanate, is a chemical compound derived from the reaction of crotonyl chloride (a colorless liquid) and potassium thiocyanate (a white crystalline compound). It is a potent organic compound with a pungent odor and is commonly used as a pesticide, fungicide, and herbicide. Crotonyl isothiocyanate is also known for its wide-ranging applications in organic synthesis and as a reagent in chemical research. It is known for its ability to induce apoptosis in cancerous cells and has potential applications in cancer treatment. Additionally, the compound is under study for its potential pharmacological properties and its role in various biochemical pathways. Despite its potential applications, crotonyl isothiocyanate should be handled with caution due to its irritant and toxic nature.
Check Digit Verification of cas no
The CAS Registry Mumber 60034-28-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,0,3 and 4 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 60034-28:
(7*6)+(6*0)+(5*0)+(4*3)+(3*4)+(2*2)+(1*8)=78
78 % 10 = 8
So 60034-28-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H5NOS/c1-2-3-5(7)6-4-8/h2-3H,1H3/b3-2+
