60093-10-9 Usage
Uses
Used in Pharmaceutical Industry:
3-AMINO-5-METHYLTHIO-1,2,4-THIADIAZOLE is used as a chemical intermediate for the synthesis of various drugs. Its unique structure and properties make it a valuable component in the development of new pharmaceutical compounds with diverse therapeutic applications.
Used in Agricultural Industry:
In the agricultural sector, 3-AMINO-5-METHYLTHIO-1,2,4-THIADIAZOLE is utilized as an intermediate in the production of pesticides. Its incorporation into these formulations helps in the development of effective pest control agents that protect crops and enhance agricultural productivity.
Used in Material Synthesis:
3-AMINO-5-METHYLTHIO-1,2,4-THIADIAZOLE can be employed in the synthesis of novel materials, where its distinctive chemical structure contributes to the creation of innovative materials with unique properties and potential applications in various industries.
Used as a Building Block for Chemical Compounds:
Due to its reactive nature and structural features, 3-AMINO-5-METHYLTHIO-1,2,4-THIADIAZOLE serves as a building block for the creation of new chemical compounds. This allows for the exploration of a wide range of applications across different fields, including but not limited to pharmaceuticals, materials science, and agrochemicals.
Used for Biological Activities:
3-AMINO-5-METHYLTHIO-1,2,4-THIADIAZOLE is known for its antimicrobial and antifungal properties, making it a potential candidate for use in applications that require the inhibition of microbial growth, such as in the development of antimicrobial agents for medical or industrial use.
Check Digit Verification of cas no
The CAS Registry Mumber 60093-10-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,0,9 and 3 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 60093-10:
(7*6)+(6*0)+(5*0)+(4*9)+(3*3)+(2*1)+(1*0)=89
89 % 10 = 9
So 60093-10-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H5N3S2/c1-7-3-5-2(4)6-8-3/h1H3,(H2,4,6)
