60282-59-9 Usage
Uses
Used in Pharmaceutical Industry:
7H-Imidazo[4,5-b]pyridin-7-one,5-amino-1,4-dihydro-(9CI) is used as a pharmaceutical intermediate for the development of new drugs. Its unique chemical structure and potential pharmacological properties make it a promising candidate for the treatment of various medical conditions.
Used in Medicinal Chemistry Research:
7H-Imidazo[4,5-b]pyridin-7-one,5-amino-1,4-dihydro-(9CI) is utilized as a research compound in medicinal chemistry. Its heterocyclic structure and functional groups provide a foundation for further chemical modifications and the exploration of its potential therapeutic effects.
Used in Drug Development:
7H-Imidazo[4,5-b]pyridin-7-one,5-amino-1,4-dihydro-(9CI) is employed as a lead compound in drug development. Its potential pharmacological properties and unique chemical structure make it a valuable starting point for the design and synthesis of new therapeutic agents.
Used in Chemical Research:
7H-Imidazo[4,5-b]pyridin-7-one,5-amino-1,4-dihydro-(9CI) is used as a chemical probe in various research areas, including organic synthesis, supramolecular chemistry, and materials science. Its heterocyclic structure and functional groups offer opportunities for the development of new chemical reactions and the exploration of its properties in different contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 60282-59-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,2,8 and 2 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 60282-59:
(7*6)+(6*0)+(5*2)+(4*8)+(3*2)+(2*5)+(1*9)=109
109 % 10 = 9
So 60282-59-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4O/c7-4-1-3(11)5-6(10-4)9-2-8-5/h1-2H,(H4,7,8,9,10,11)
