60302-96-7 Usage
Uses
Used in Textile Industry:
3-(Dipropylamino)propane-1,2-diol is used as an additive in the production of dyeable and flame-retarded thermoplastic polyurethane fibers. Its incorporation into the fibers enhances their dyeability, allowing for a wider range of color options and improved aesthetic appeal. Additionally, the compound's presence in the fibers contributes to their flame-retardant properties, making them safer for use in various applications where fire resistance is a concern.
Used in Plastics and Polymer Industry:
3-(Dipropylamino)propane-1,2-diol can also be utilized in the development of flame-retardant plastics and polymers. Its addition to the polymer matrix can improve the material's resistance to ignition and slow down the spread of fire, making it a valuable component in the creation of safer plastic products for various applications, including electronics, automotive, and construction.
Check Digit Verification of cas no
The CAS Registry Mumber 60302-96-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,3,0 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 60302-96:
(7*6)+(6*0)+(5*3)+(4*0)+(3*2)+(2*9)+(1*6)=87
87 % 10 = 7
So 60302-96-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H21NO2/c1-3-5-10(6-4-2)7-9(12)8-11/h9,11-12H,3-8H2,1-2H3
