60302-96-7 Usage
Description
3-(Dipropylamino)propane-1,2-diol is an organic compound characterized by its unique molecular structure, featuring a propane backbone with a dipropylamino group attached to the third carbon and two hydroxyl groups on the first and second carbons. This structure endows it with specific properties that make it suitable for various applications across different industries.
Uses
Used in Textile Industry:
3-(Dipropylamino)propane-1,2-diol is used as an additive in the production of dyeable and flame-retarded thermoplastic polyurethane fibers. Its incorporation into the fibers enhances their dyeability, allowing for a wider range of color options and improved aesthetic appeal. Additionally, the compound's presence in the fibers contributes to their flame-retardant properties, making them safer for use in various applications where fire resistance is a concern.
Used in Plastics and Polymer Industry:
3-(Dipropylamino)propane-1,2-diol can also be utilized in the development of flame-retardant plastics and polymers. Its addition to the polymer matrix can improve the material's resistance to ignition and slow down the spread of fire, making it a valuable component in the creation of safer plastic products for various applications, including electronics, automotive, and construction.
Check Digit Verification of cas no
The CAS Registry Mumber 60302-96-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,3,0 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 60302-96:
(7*6)+(6*0)+(5*3)+(4*0)+(3*2)+(2*9)+(1*6)=87
87 % 10 = 7
So 60302-96-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H21NO2/c1-3-5-10(6-4-2)7-9(12)8-11/h9,11-12H,3-8H2,1-2H3
