The chemical compound in question is a complex organometallic molecule consisting of two ((C6H5)3P)2N+ cations and one Ni9(CO)18 2- anion. The cations are composed of two trityl groups (C6H5)3P, which are triphenylphosphine groups, bonded to a nitrogen atom with a +1 charge. The anion is a nickel cluster with nine nickel atoms, each coordinated to a carbon monoxide ligand, resulting in a total of 18 CO ligands. The overall charge of the anion is -2, balancing the +2 charge from the two cations. 2((C6H5)3P)2N(1+)*Ni9(CO)18(2-)=(((C6H5)3P)2N)2(Ni9(CO)18) is a representative of cluster chemistry, where multiple metal atoms are bonded together, and it showcases the coordination chemistry involving phosphorus and nickel.
The CAS Registry Mumber 60512-59-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,5,1 and 2 respectively; the second part has 2 digits, 5 and 9 respectively. Calculate Digit Verification of CAS Registry Number 60512-59: (7*6)+(6*0)+(5*5)+(4*1)+(3*2)+(2*5)+(1*9)=96 96 % 10 = 6 So 60512-59-6 is a valid CAS Registry Number.