60758-41-0 Usage
Uses
Used in Pesticide Industry:
Thiazole-2-carbothioic acid amide is used as a pesticide for controlling nematodes and other soil-borne pathogens. It is effective due to its interference with the metabolic processes of these organisms, which ultimately results in their death.
Used in Pharmaceutical Industry:
As a pharmaceutical intermediate, thiazole-2-carbothioic acid amide plays a crucial role in the synthesis of various pharmaceutical compounds, contributing to the development of new drugs and therapies.
Used in Chemical Production:
In the chemical industry, thiazole-2-carbothioic acid amide is utilized in the production of dyes and other chemicals, highlighting its versatility in different chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 60758-41-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,7,5 and 8 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 60758-41:
(7*6)+(6*0)+(5*7)+(4*5)+(3*8)+(2*4)+(1*1)=130
130 % 10 = 0
So 60758-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2S2/c5-3(7)4-6-1-2-8-4/h1-2H,(H2,5,7)
