60788-02-5 Usage
Uses
Given the provided materials, specific uses for (2,5-DIOXO-1-PHENYL-PYRROLIDIN-3-YLSULFANYL)-ACETIC ACID are not explicitly stated. However, based on the compound's structural components, we can hypothesize potential applications in various industries:
Used in Pharmaceutical Industry:
(2,5-DIOXO-1-PHENYL-PYRROLIDIN-3-YLSULFANYL)-ACETIC ACID could be used as a building block or intermediate in the synthesis of pharmaceutical compounds due to its diverse functional groups, which may contribute to the development of new drugs with specific therapeutic properties.
Used in Chemical Research:
As a complex compound with multiple reactive sites, (2,5-DIOXO-1-PHENYL-PYRROLIDIN-3-YLSULFANYL)-ACETIC ACID may serve as a subject of study in chemical research to explore its reactivity, stability, and potential interactions with other molecules for the advancement of organic chemistry.
Used in Material Science:
(2,5-DIOXO-1-PHENYL-PYRROLIDIN-3-YLSULFANYL)-ACETIC ACID's structural components might lend itself to the development of new materials with unique properties, such as polymers or other composites, where its phenyl, pyrrolidin, and sulfanyl groups could influence the material's characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 60788-02-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,7,8 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 60788-02:
(7*6)+(6*0)+(5*7)+(4*8)+(3*8)+(2*0)+(1*2)=135
135 % 10 = 5
So 60788-02-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO4S/c14-10-6-9(18-7-11(15)16)12(17)13(10)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,15,16)
