612845-46-2 Usage
Uses
Used in Organic Synthesis:
5-BROMO-2-ETHOXY-4-PYRIDINEBORONIC ACID is used as a building block in organic synthesis for creating complex molecules and pharmaceuticals. Its reactivity allows for the formation of new chemical bonds and the synthesis of a wide range of compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-BROMO-2-ETHOXY-4-PYRIDINEBORONIC ACID is utilized as a building block for the development of new drugs. Its unique structure contributes to the design and synthesis of potential therapeutic agents.
Used in Cross-Coupling Reactions:
5-BROMO-2-ETHOXY-4-PYRIDINEBORONIC ACID serves as a reagent in cross-coupling reactions, which are essential for the formation of carbon-carbon and carbon-heteroatom bonds. These reactions are crucial in the synthesis of various organic compounds and materials.
Used as a Ligand in Coordination Chemistry:
In coordination chemistry, 5-BROMO-2-ETHOXY-4-PYRIDINEBORONIC ACID is employed as a ligand, interacting with metal ions to form coordination complexes. These complexes have potential applications in catalysis, materials science, and other areas.
Used in Drug Development:
5-BROMO-2-ETHOXY-4-PYRIDINEBORONIC ACID has potential applications in the development of new drugs, as its unique structure and reactivity can contribute to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in Agrochemical Development:
This chemical compound is also utilized in the development of agrochemicals, such as pesticides and herbicides. Its reactivity and structural features can be harnessed to create new molecules with enhanced biological activity and selectivity.
Used in Materials Science:
5-BROMO-2-ETHOXY-4-PYRIDINEBORONIC ACID has potential applications in materials science, where its unique properties can be exploited to develop new materials with specific characteristics, such as conductivity, magnetism, or optical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 612845-46-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,1,2,8,4 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 612845-46:
(8*6)+(7*1)+(6*2)+(5*8)+(4*4)+(3*5)+(2*4)+(1*6)=152
152 % 10 = 2
So 612845-46-2 is a valid CAS Registry Number.
InChI:InChI=1S/C7H9BBrNO3/c1-2-13-7-3-5(8(11)12)6(9)4-10-7/h3-4,11-12H,2H2,1H3
612845-46-2Relevant academic research and scientific papers
New shelf-stable halo- and alkoxy-substituted pyridylboronic acids and their suzuki cross-coupling reactions to yield heteroarylpyridines
Parry, Paul R.,Bryce, Martin R.,Tarbit, Brian
, p. 1035 - 1038 (2007/10/03)
New shelf-stable pyridylboronic acids have been synthesized: bromine-lithium exchange followed by reaction with triisopropylborate (TIPB) yielded 2-fluoro-5-pyridylboronic acid (4), 3-bromo-5-pyridylboronic acid (5) and 2-ethoxy-5-pyridylboronic acid (6);
