61296-00-2 Usage
Type of Compound
Heterocyclic compound
Pyridine ring
A six-membered nitrogen-containing ring
Two methyl substituents
Attached to the pyridine ring
Furfurylideneamino substituent
A furan ring with an exocyclic double bond and an amino group attached to the pyridine ring
Nitrile functional group
A carbon-nitrogen triple bond (C≡N) present in the molecule
Oxo functional group
A carbonyl group (C=O) present in the molecule
Organic synthesis
Used as a versatile building block for creating various organic compounds
Medicinal chemistry
Possesses potential biological activities and can be used in the development of pharmaceuticals
Complex structure
The combination of different functional groups and heteroatoms provides a unique structure
Versatility
The presence of multiple functional groups allows for further chemical modifications and reactions
Biological Activities
Not explicitly mentioned in the material, but the compound is suggested to have potential biological activities, which could be explored in future research
Synthesis
Commonly used in organic synthesis, indicating that it can be synthesized through various chemical reactions and pathways
Medicinal Chemistry Relevance
Its unique structure and functional groups make it a valuable compound for the development of new pharmaceuticals and organic compounds with potential therapeutic applications
Check Digit Verification of cas no
The CAS Registry Mumber 61296-00-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,2,9 and 6 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 61296-00:
(7*6)+(6*1)+(5*2)+(4*9)+(3*6)+(2*0)+(1*0)=112
112 % 10 = 2
So 61296-00-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N3O2/c1-9-6-10(2)16(13(17)12(9)7-14)15-8-11-4-3-5-18-11/h3-6,8H,1-2H3
