61563-43-7 Usage
Description
Isoquinoline-8-carboxylic acid, a heterocyclic organic compound with the molecular formula C10H7NO2, is a derivative of isoquinoline. It is a versatile chemical intermediate used in the synthesis of various organic compounds and pharmaceuticals. Its potential pharmacological activities, such as anti-inflammatory and anti-cancer properties, have been extensively studied, making it a promising candidate for therapeutic applications. Additionally, it serves as a building block in the production of dyes and pigments, showcasing its diverse utility in different industries.
Uses
Used in Pharmaceutical Industry:
Isoquinoline-8-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its potential pharmacological activities, such as anti-inflammatory and anti-cancer properties, have been extensively studied, making it a promising candidate for the development of new therapeutic agents.
Used in Organic Synthesis:
Isoquinoline-8-carboxylic acid is used as a building block in the synthesis of various organic compounds. Its unique structure and functional groups make it a valuable component in the creation of complex organic molecules, contributing to the advancement of organic chemistry.
Used in Dye and Pigment Production:
Isoquinoline-8-carboxylic acid is used as a key component in the production of dyes and pigments. Its ability to form stable chromophores and its compatibility with various substrates make it an essential ingredient in the formulation of colorants for various applications, such as textiles, plastics, and printing inks.
Used in Research and Development:
Isoquinoline-8-carboxylic acid is used in research studies to explore its potential therapeutic applications and to understand its pharmacological properties. Its diverse range of activities, including anti-inflammatory and anti-cancer effects, makes it an attractive target for drug discovery and development efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 61563-43-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,5,6 and 3 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 61563-43:
(7*6)+(6*1)+(5*5)+(4*6)+(3*3)+(2*4)+(1*3)=117
117 % 10 = 7
So 61563-43-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO2/c12-10(13)8-3-1-2-7-4-5-11-6-9(7)8/h1-6H,(H,12,13)