616-03-5 Usage
Chemical Properties
White Crystalline Solid
Uses
Different sources of media describe the Uses of 616-03-5 differently. You can refer to the following data:
1. 5-Methylhydantoin is a derivative of Hydantoin (H675000), a heterocyclic compound used to synthesis various pharmaceutical goods including anticonvulsants such as fosphenytoin (F728900).
2. 5-Methylhydantoin is usede as a reactant for preparation of N-chlorohydantoin, Mitsunobu reaction, Pseudomonas putida strain allowing conversion into L-amino acids, D-hydantoinase from Agrobacteria tumefaceins and enzymatic racemization.
Check Digit Verification of cas no
The CAS Registry Mumber 616-03-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,1 and 6 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 616-03:
(5*6)+(4*1)+(3*6)+(2*0)+(1*3)=55
55 % 10 = 5
So 616-03-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N2O2/c1-2-3(7)6-4(8)5-2/h2H,1H3,(H2,5,6,7,8)/t2-/m0/s1
