61655-58-1

Usage

InChI:InChI=1/C8H11ClN4.ClH/c9-7-5-11-6-8(12-7)13-3-1-10-2-4-13;/h5-6,10H,1-4H2;1H

Upstream product

• 110-85-0 piperazine 
• 4774-14-5 2,6-dichloropyrazine 
• 426829-52-9 tert-Butyl 4-(6-Chloro-2-Pyrazinyl)-1-Piperazinecarboxylate 

Relevant academic research and scientific papers

Piperazinylacylpiperidine derivatives, their preparation and therapeutic use thereof

The invention relates to substituted 1-piperazinylacylpiperidine derivatives of general formula (I) in which: n is 1 or 2; p is 1 or 2; R1 represents a halogen atom; a trifluoromethyl radical; a (C1-C4)alkyl; a (C1-C4)alkoxy; a trifluoromethoxy radical; R2 represents a hydrogen atom or a halogen atom; R3 represents a hydrogen atom; a group —OR5; a group —CH2OR5; a group —NR6R7; a group —NR8COR9; a group —NR8CONR10R11; a group —CH2NR12R13; a group —CH2NR8CONR14R15; a (C1-C4)alkoxycarbonyl; a group —CONR16R17; or else R3 constitutes a double bond between the carbon atom to which it is attached and the adjacent carbon atom of the piperidine ring; R4 represents an aromatic group selected from: the said aromatic groups being unsubstituted or being mono- or disubstituted by a substituent selected independently from a halogen atom; a (C1-C4)alkyl; a (C1-C4)alkoxy; a trifluoromethyl radical; Preparation process and therapeutic application.

PHENYLPYRIDINE CARBONYL PIPERAZINE DERIVATIVE

The present invention relates to a compound which is represented by the following general formula and has type 4 phosphodiesterase inhibitory action, and uses and an intermediate compound thereof. (whereinR1, R2: hydrogen, a halogen, a lower alkyl, a lower alkoxy, or the like,R3, R4: hydrogen, a (substituted) lower alkyl, a halogen, or the like,R5: hydrogen, a lower alkyl, a lower alkoxycarbonyl, or the like, andn: 0 or 1).

1,2,4-TRIAZOL-3-ONE ANTIDEPRESSANTS

Phenoxyalkyl substituted-1,2,4-triazolones having anti-depressant properties typified by 2-3-4-(3-chlorophenyl)-1-piperazinyl!propyl!-5-ethyl-4-(2-phenoxyethyl)-2H-1,2, 4-triazol-3(4H)-one are disclosed.

Piperazinylpyrazines

Compounds of the formula: STR1 and their N-oxides and acid-addition salts are disclosed having pharmacological activity as anorexic agents.

6-Chloro-2-(1-piperazinyl)pyrazine

The compound 6-chloro-2-(1'-piperazinyl)pyrazine, its N-oxides and acid-addition salts are disclosed having pharmacological activity as anorexic agents.