61856-49-3 Usage
Uses
Used in Pharmaceutical Industry:
1,2-dihydro-1-phenyl-2-thioxonicotinaldehyde serves as an intermediate in the synthesis of various pharmaceuticals, contributing to the development of new medications due to its unique chemical structure and properties.
Used in Agrochemical Industry:
1,2-dihydro-1-phenyl-2-thioxonicotinaldehyde is also utilized as an intermediate in the production of agrochemicals, playing a role in the creation of substances that help protect and enhance crop yields.
Used in Organic Synthesis:
1,2-dihydro-1-phenyl-2-thioxonicotinaldehyde is employed as a building block in organic synthesis, allowing for the construction of more complex molecules with potential applications in various fields.
Used in Medicinal Chemistry:
Due to its heterocyclic ring structure and functional groups, 1,2-dihydro-1-phenyl-2-thioxonicotinaldehyde is used in medicinal chemistry for the design and synthesis of new pharmaceuticals, potentially leading to the discovery of novel treatments for a range of diseases.
Used in Biological Research:
1,2-dihydro-1-phenyl-2-thioxonicotinaldehyde is used in biological research to explore its antifungal and anti-inflammatory properties, which may contribute to the development of new therapeutic agents for treating infections and inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 61856-49-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,8,5 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 61856-49:
(7*6)+(6*1)+(5*8)+(4*5)+(3*6)+(2*4)+(1*9)=143
143 % 10 = 3
So 61856-49-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H9NOS/c14-9-10-5-4-8-13(12(10)15)11-6-2-1-3-7-11/h1-9H
