62176-35-6 Usage
Uses
Used in Pharmaceutical Industry:
5-bromo-2-[(3-chlorobenzyl)oxy]benzoic acid is used as a building block for the synthesis of various pharmaceuticals and organic compounds. Its unique structure allows it to be a key intermediate in the production of anti-inflammatory and anti-cancer drugs, contributing to the development of new therapeutic agents.
Used in Chemical Research:
Due to its distinctive properties, 5-bromo-2-[(3-chlorobenzyl)oxy]benzoic acid is utilized in chemical research to explore its potential applications and interactions with other compounds. This helps in understanding its role in various chemical reactions and its potential as a precursor for the synthesis of other complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 62176-35-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,1,7 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 62176-35:
(7*6)+(6*2)+(5*1)+(4*7)+(3*6)+(2*3)+(1*5)=116
116 % 10 = 6
So 62176-35-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H10BrClO3/c15-10-4-5-13(12(7-10)14(17)18)19-8-9-2-1-3-11(16)6-9/h1-7H,8H2,(H,17,18)
62176-35-6Relevant academic research and scientific papers
NOVEL COMPOUNDS
-
Page/Page column 54; 55, (2011/04/25)
The present invention discloses novel compounds inhibiting LRRK2 kinase activity, the preparation processes thereof, the compositions containing them, as well as the use in treating diseases characterized by LRRK2 kinase activity, particularly Parkinson's disease and Alzheimer's disease.
