6232-85-5 Usage
Uses
Used in Pharmaceutical Industry:
4-Ethyl-5-methyl-4H-1,2,4-triazole-3-thiol serves as a building block in the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for the creation of molecules with specific biological activities, making it a valuable component in medicinal research.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Ethyl-5-methyl-4H-1,2,4-triazole-3-thiol is utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness and selectivity, leading to improved agricultural outcomes.
Used in Materials Science:
4-Ethyl-5-methyl-4H-1,2,4-triazole-3-thiol is also employed in materials science, where it can be used to develop new materials with specific properties. Its unique structure allows for the creation of materials with tailored characteristics, such as improved stability or enhanced performance in various applications.
Used as a Catalyst in Organic Synthesis:
4-ETHYL-5-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL is utilized as a catalyst in organic synthesis, facilitating chemical reactions and improving the efficiency of the synthesis process. Its presence can accelerate reaction rates and increase the yield of desired products, making it a valuable tool in the field of organic chemistry.
Used as a Corrosion Inhibitor:
4-Ethyl-5-methyl-4H-1,2,4-triazole-3-thiol is also used as a corrosion inhibitor, protecting materials from degradation and extending their service life. Its application in this area can help to reduce maintenance costs and improve the longevity of various industrial components.
Check Digit Verification of cas no
The CAS Registry Mumber 6232-85-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,3 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6232-85:
(6*6)+(5*2)+(4*3)+(3*2)+(2*8)+(1*5)=85
85 % 10 = 5
So 6232-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3S/c1-3-8-4(2)6-7-5(8)9/h3H2,1-2H3,(H,7,9)
6232-85-5Relevant academic research and scientific papers
COMPOUNDS FOR MODULATING AQUAPORINS
-
Page/Page column 32, (2017/12/08)
The invention relates to compounds of formula (I) pharmaceutical compositions thereof and methods for modulating aquaporin 9.
Synthesis and biological evaluations of sulfanyltriazoles as novel HIV-1 non-nucleoside reverse transcriptase inhibitors
Wang, Zhiwei,Wu, Baogen,Kuhen, Kelli L.,Bursulaya, Badry,Nguyen, Truc N.,Nguyen, Deborah G.,He, Yun
, p. 4174 - 4177 (2007/10/03)
A novel sulfanyltriazole was discovered as an HIV-1 non-nucleoside reverse transcriptase inhibitor via HTS using a cell-based assay. Chemical modifications and molecular modeling studies were carried out to establish its SAR and understand its interactions with the enzyme. These modifications led to the identification of sulfanyltriazoles with low nanomolar potency for inhibiting HIV-1 replication and promising activities against selected NNRTI resistant mutants. These novel and potent sulfanyltriazoles could serve as advanced leads for further optimization.
