62625-15-4 Usage
General Description
Phenolphthalein dibutyrate is a chemical compound that is derived from phenolphthalein, a pH indicator commonly used in laboratory settings. It is produced by esterifying two butyric acid molecules to the phenolphthalein molecule. This process not only modifies the solubility and physical characteristics of the compound, but also changes its color properties. Phenolphthalein dibutyrate is often used in biochemical and medical research as a substrate for lipase enzymes, allowing for the detection and quantification of lipase activity in various biological samples. Additionally, it has potential applications in the development of pharmaceuticals and drug delivery systems due to its unique properties and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 62625-15-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,6,2 and 5 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 62625-15:
(7*6)+(6*2)+(5*6)+(4*2)+(3*5)+(2*1)+(1*5)=114
114 % 10 = 4
So 62625-15-4 is a valid CAS Registry Number.
InChI:InChI=1/C28H26O6/c1-3-7-25(29)32-21-15-11-19(12-16-21)28(24-10-6-5-9-23(24)27(31)34-28)20-13-17-22(18-14-20)33-26(30)8-4-2/h5-6,9-18H,3-4,7-8H2,1-2H3