627463-18-7 Usage
Uses
Used in Organic Synthesis:
Benzene, 4-bromo-1-ethyl-2-fluoro(9CI) is used as a reagent in organic synthesis for its ability to participate in various chemical reactions, such as electrophilic substitution, nucleophilic substitution, and addition reactions. Its presence of bromine, ethyl, and fluorine atoms allows for the formation of a wide range of organic compounds with different functional groups.
Used in Pharmaceutical Research:
In the pharmaceutical industry, Benzene, 4-bromo-1-ethyl-2-fluoro(9CI) serves as an intermediate in the synthesis of various drug molecules. Its unique structure can be further modified to create new compounds with potential therapeutic properties. Researchers utilize Benzene, 4-bromo-1-ethyl-2-fluoro- (9CI) to explore novel drug candidates and optimize their pharmacological profiles.
Used in Agrochemical Production:
Benzene, 4-bromo-1-ethyl-2-fluoro(9CI) is also employed in the production of agrochemicals, such as pesticides and herbicides. Its halogenated nature and functional groups can be utilized to create compounds with effective pesticidal or herbicidal properties, contributing to the development of new and improved agrochemical products.
Used in Other Industries:
Due to its versatile chemical properties, Benzene, 4-bromo-1-ethyl-2-fluoro(9CI) finds applications in various other industries, such as the synthesis of dyes, polymers, and other specialty chemicals. Its unique structure and reactivity make it a valuable building block for the development of new materials with specific properties and applications.
However, it is crucial to handle Benzene, 4-bromo-1-ethyl-2-fluoro(9CI) with care due to its potential health hazards, including skin and eye irritation. Additionally, its environmental impact should be considered, as improper disposal or release can lead to contamination and harm to ecosystems. Proper safety measures, waste management, and regulatory compliance are essential when working with Benzene, 4-bromo-1-ethyl-2-fluoro- (9CI).
Check Digit Verification of cas no
The CAS Registry Mumber 627463-18-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,2,7,4,6 and 3 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 627463-18:
(8*6)+(7*2)+(6*7)+(5*4)+(4*6)+(3*3)+(2*1)+(1*8)=167
167 % 10 = 7
So 627463-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrF/c1-2-6-3-4-7(9)5-8(6)10/h3-5H,2H2,1H3
627463-18-7Relevant academic research and scientific papers
DIAMINOTHIAZOLES
-
Page/Page column 26, (2010/02/05)
The present invention is directed to novel diaminothiazoles of formula These compounds inhibit cyclin-dependent kinase 4 (Cdk4) and are selective against Cdk2 and Cdk1. These compounds and their pharmaceutically acceptable salts and esters have antiproliferative activity and are useful in the treatment or control of cancer, in particular solid tumors. This invention is also directed to pharmaceutical compositions containing such compounds and to methods of treating or controlling cancer, most particularly the treatment 6r control of breast, lung and colon and prostate tumors.
