62813-85-8 Usage
General Description
1H-INDOLE,7-BROMO-2,3-DIHYDRO- is a chemical compound with the molecular formula C8H8BrN. It is a derivative of the heterocyclic compound indole, which is commonly found in certain plant-based substances. The presence of a bromine atom at the 7th position of the indole ring makes this compound distinct. 1H-INDOLE,7-BROMO-2,3-DIHYDRO- may have potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. Its specific properties and potential uses would depend on further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 62813-85-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,8,1 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 62813-85:
(7*6)+(6*2)+(5*8)+(4*1)+(3*3)+(2*8)+(1*5)=128
128 % 10 = 8
So 62813-85-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-3,10H,4-5H2
