62813-85-8 Usage
Uses
Used in Pharmaceutical Industry:
1H-INDOLE,7-BROMO-2,3-DIHYDROis used as a pharmaceutical compound for its potential therapeutic properties. The presence of the bromine atom may contribute to its pharmacological activity, making it a candidate for the development of new drugs. Further research is needed to explore its potential applications in treating various diseases and conditions.
Used in Agrochemical Industry:
1H-INDOLE,7-BROMO-2,3-DIHYDROis used as an agrochemical compound for its potential applications in crop protection and plant growth regulation. The indole structure and bromine substitution may provide unique properties that can be harnessed for the development of new agrochemical products. Further studies are required to determine its effectiveness and safety in agricultural settings.
Used in Materials Science:
1H-INDOLE,7-BROMO-2,3-DIHYDROis used as a material in the field of materials science for its potential properties in creating new materials with unique characteristics. The indole ring and bromine atom may contribute to the compound's stability, reactivity, or other properties that can be utilized in the development of advanced materials for various applications. Further research is necessary to explore its potential in this field.
Check Digit Verification of cas no
The CAS Registry Mumber 62813-85-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,8,1 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 62813-85:
(7*6)+(6*2)+(5*8)+(4*1)+(3*3)+(2*8)+(1*5)=128
128 % 10 = 8
So 62813-85-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-3,10H,4-5H2
