6284-26-0 Usage
Uses
Used in Organic Synthesis:
2-(4-Bromo-3-oxo-butyl)-1H-isoindole-1,3(2H)-dione is used as a synthetic intermediate for the creation of various organic compounds. Its unique functional groups, including the bromine atom, the isoindole, and the dione structure, provide versatility in chemical reactions, facilitating the synthesis of a wide array of target molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(4-Bromo-3-oxo-butyl)-1H-isoindole-1,3(2H)-dione is utilized as a starting material for the development of new drugs. Its structural features can be modified to explore potential medicinal properties, offering a foundation for the creation of novel therapeutic agents.
Used in Chemical Research:
2-(4-BROMO-3-OXOBUTYL)-1H-ISOINDOLE-1,3(2H)-DIONE is also employed in academic and industrial research settings to study the properties of complex organic molecules. Its reactivity and structural characteristics make it an interesting subject for investigations into reaction mechanisms, synthetic methodologies, and the development of new chemical processes.
Used in Material Science:
2-(4-Bromo-3-oxo-butyl)-1H-isoindole-1,3(2H)-dione may find applications in material science, where its unique structure could contribute to the development of new materials with specific properties, such as improved stability, reactivity, or selectivity in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 6284-26-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6284-26:
(6*6)+(5*2)+(4*8)+(3*4)+(2*2)+(1*6)=100
100 % 10 = 0
So 6284-26-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H8BrNO3/c12-5-7(14)6-13-10(15)8-3-1-2-4-9(8)11(13)16/h1-4H,5-6H2
6284-26-0Relevant academic research and scientific papers
REVERSE HYDROXAMATE INHIBITORS OF MATRIX METALLOPROTEINASES
-
, (2008/06/13)
Compounds having the formula are matrix metalloproteinase inhibitors. Also disclosed are matrix metalloproteinase-inhibiting compositions and methods of inhibiting matrix metalloproteinase in a mammal.
