62853-55-8 Usage
Uses
Used in Chemical Reactions:
Methyl-2-deoxy-beta-D-ribofuranoside diacetate is used as an intermediate in various chemical reactions for its unique functional groups and properties. Its versatility in reactions makes it a valuable component in the synthesis of other organic compounds and pharmaceuticals.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, Methyl-2-deoxy-beta-D-ribofuranoside diacetate is used as a key intermediate in the synthesis of nucleoside analogs and antiviral drugs. Its unique structure allows for the development of compounds with specific biological activities, making it an essential component in medicinal chemistry.
Used in Research and Development:
Methyl-2-deoxy-beta-D-ribofuranoside diacetate is utilized in research and development for studying the structure and function of nucleosides and nucleotides. Its unique properties provide insights into the mechanisms of nucleic acid synthesis and the development of novel therapeutic agents.
Used in Laboratory Settings:
As a laboratory-grade chemical, Methyl-2-deoxy-beta-D-ribofuranoside diacetate is used in various laboratory settings for conducting experiments and testing its reactivity and potential applications. Its careful handling and controlled environment ensure the safety and accuracy of experimental results.
Check Digit Verification of cas no
The CAS Registry Mumber 62853-55-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,8,5 and 3 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 62853-55:
(7*6)+(6*2)+(5*8)+(4*5)+(3*3)+(2*5)+(1*5)=138
138 % 10 = 8
So 62853-55-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H11O4.2C2H4O2/c1-9-4-2-6(8)10-5(4)3-7;2*1-2(3)4/h4-7H,2-3H2,1H3;2*1H3,(H,3,4)/q-1;;/p-2/t4-,5+,6+;;/m0../s1
62853-55-8Relevant academic research and scientific papers
Diastereoselective enzymatic preparation of acetylated pentofuranosides carrying free 5-hydroxyl groups
Gudino, Esteban D.,Iribarren, Adolfo M.,Iglesias, Luis E.
experimental part, p. 1813 - 1816 (2009/12/26)
Methyl 3-O-acetyl-2-deoxy-α-d-ribofuranoside, 1,3-di-O-acetyl-2-deoxy-α-d-ribofuranose and 1,2,3-tri-O-acetyl-α-d-arabinofuranose were diastereoselectively prepared (de = 100%) from anomeric mixtures of the corresponding 5-acetylated compounds through Can
