62880-67-5 Usage
Uses
Used in Pharmaceutical Industry:
5-Bromo-2-chloro-4-(1-piperidinyl)pyrimidine is used as a building block for the synthesis of pharmaceuticals due to its potential biological activity and its role in the development of new drugs. Its unique chemical structure allows for the creation of a wide range of therapeutic agents with diverse applications.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Bromo-2-chloro-4-(1-PIPERIDINYL)PYRIMIDINE is used as a building block for the synthesis of agrochemicals, contributing to the development of new pesticides and other agricultural chemicals. Its versatility in chemical synthesis enables the creation of compounds with targeted effects on pests and diseases, enhancing crop protection and yield.
Used in Medicinal Chemistry Research:
5-Bromo-2-chloro-4-(1-piperidinyl)pyrimidine is utilized as a research compound in medicinal chemistry, where it serves as a precursor for the synthesis of various heterocyclic compounds. Its unique properties make it an ideal candidate for exploring new chemical pathways and discovering novel therapeutic agents.
Used in Drug Discovery:
As a key component in drug discovery, 5-Bromo-2-chloro-4-(1-piperidinyl)pyrimidine plays a crucial role in the identification and development of new pharmaceutical agents. Its potential biological activity and ability to be modified through chemical synthesis make it a valuable tool in the search for innovative treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 62880-67-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,8,8 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 62880-67:
(7*6)+(6*2)+(5*8)+(4*8)+(3*0)+(2*6)+(1*7)=145
145 % 10 = 5
So 62880-67-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BrClN3/c10-7-6-12-9(11)13-8(7)14-4-2-1-3-5-14/h6H,1-5H2
62880-67-5Relevant academic research and scientific papers
Synthesis of trisubstituted pyrimidines by regioselective SNAr and Suzuki reactions of polyhalopyrimidines
Large, Jonathan M.,Clarke, Maria,Williamson, David M.,McDonald, Edward,Collins, Ian
, p. 861 - 864 (2007/10/03)
An efficient, regioselective approach to the synthesis of trisubstituted pyrimidines was developed. Sequential functionalisation of commercially available polyhalopyrimidines provided the target compounds in moderate to good overall yields. Georg Thieme V
