630399-84-7 Usage
Uses
Used in Pharmaceutical Industry:
4-CYCLOPROPYL-3-OXO-BUTYRIC ACID ETHYL ESTER is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of various drugs.
Used in Chemical Research:
4-CYCLOPROPYL-3-OXO-BUTYRIC ACID ETHYL ESTER is utilized as a research compound in chemical studies, allowing scientists to explore its properties and potential applications in the creation of new organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 630399-84-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,0,3,9 and 9 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 630399-84:
(8*6)+(7*3)+(6*0)+(5*3)+(4*9)+(3*9)+(2*8)+(1*4)=167
167 % 10 = 7
So 630399-84-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O3/c1-2-12-9(11)6-8(10)5-7-3-4-7/h7H,2-6H2,1H3
630399-84-7Relevant academic research and scientific papers
NITROGEN-CONTAINING HETEROCYCLIC COMPOUND OR SALT THEREOF
-
Paragraph 3446; 3447; 3448, (2015/11/30)
A compound represented by Formula [1] (in the formula, Z1 represents N, CH, or the like; X1 represents NH or the like; R1 represents a heteroaryl group or the like; each of R2, R3, and R4 represents a hydrogen atom, a halogen atom, an alkoxy group, or the like; and R5 represents a heteroaryl group or the like) or salt thereof.
