63042-19-3 Usage
Description
1,3,5(10)-Estratriene-3,17β-diol 17-benzoate 3-butanoate is a synthetically derived compound characterized by its complex chemical structure. It is a derivative of estradiol, a hormone integral to the female reproductive system. 1,3,5(10)-Estratriene-3,17β-diol 17-benzoate 3-butanoate is composed of three distinct parts: the estratriene core, a benzoate group featuring a benzene ring with a carboxylic acid ester, and a butanoate group which includes a four-carbon chain with a carboxylic acid ester. Its intricate molecular design positions it as a valuable asset in research and pharmaceutical applications, particularly for the study of hormone signaling pathways and the development of hormone-based therapeutics.
Uses
Used in Pharmaceutical Research:
1,3,5(10)-Estratriene-3,17β-diol 17-benzoate 3-butanoate is utilized as a research compound for understanding the mechanisms of hormone signaling pathways. Its structural similarity to estradiol allows scientists to investigate the interactions of hormones with their receptors and the subsequent cellular responses.
Used in Hormone-Based Medication Development:
In the pharmaceutical industry, 1,3,5(10)-Estratriene-3,17β-diol 17-benzoate 3-butanoate serves as a key component in the development of hormone-based medications. Its unique structure can be modified to create new drugs that target specific hormone receptors, potentially leading to more effective treatments for conditions related to hormonal imbalances or deficiencies.
Check Digit Verification of cas no
The CAS Registry Mumber 63042-19-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,0,4 and 2 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 63042-19:
(7*6)+(6*3)+(5*0)+(4*4)+(3*2)+(2*1)+(1*9)=93
93 % 10 = 3
So 63042-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C29H34O4/c1-3-7-27(30)32-21-11-13-22-20(18-21)10-12-24-23(22)16-17-29(2)25(24)14-15-26(29)33-28(31)19-8-5-4-6-9-19/h4-6,8-9,11,13,18,23-26H,3,7,10,12,14-17H2,1-2H3