6318-03-2 Usage
General Description
"(1S,2S)-2-(6-dimethylaminopurin-9-yl)cyclohexan-1-ol" is a chemical compound with the molecular formula C16H23N5O. It is a derivative of cyclohexanol and purine, and it contains a dimethylaminopurinyl group attached to the cyclohexanol ring. (1S,2S)-2-(6-dimethylaminopurin-9-yl)cyclohexan-1-ol may have potential biological activity due to its purine moiety, which is a common component of nucleic acids and various important cellular compounds. Its unique structure and composition make it a valuable target for scientific research and potential pharmaceutical development.
Check Digit Verification of cas no
The CAS Registry Mumber 6318-03-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6318-03:
(6*6)+(5*3)+(4*1)+(3*8)+(2*0)+(1*3)=82
82 % 10 = 2
So 6318-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H19N5O/c1-17(2)12-11-13(15-7-14-12)18(8-16-11)9-5-3-4-6-10(9)19/h7-10,19H,3-6H2,1-2H3/t9-,10-/m0/s1