6318-03-2 Usage
Uses
Used in Pharmaceutical Development:
(1S,2S)-2-(6-dimethylaminopurin-9-yl)cyclohexan-1-ol is utilized as a pharmaceutical candidate for potential applications in the development of new drugs. Its purine moiety, which is a common component of nucleic acids and other essential cellular compounds, suggests that it may have biological activity that could be harnessed for therapeutic purposes.
Used in Scientific Research:
In the field of scientific research, (1S,2S)-2-(6-dimethylaminopurin-9-yl)cyclohexan-1-ol serves as a valuable compound for studying the effects of its unique structure and composition on biological systems. This can lead to a better understanding of its potential interactions with cellular components and its role in various biological processes.
Used in Drug Design and Discovery:
(1S,2S)-2-(6-dimethylaminopurin-9-yl)cyclohexan-1-ol is employed as a starting point for drug design and discovery efforts. Its distinctive features and potential biological activity make it an attractive candidate for the development of novel therapeutic agents that could target specific diseases or conditions.
Used in Biochemical Studies:
In biochemical studies, (1S,2S)-2-(6-dimethylaminopurin-9-yl)cyclohexan-1-ol is used to investigate its interactions with enzymes, proteins, and other biomolecules. This can provide insights into its potential role in cellular processes and its applicability in the development of new pharmaceuticals.
Used in Chemical Synthesis:
(1S,2S)-2-(6-dimethylaminopurin-9-yl)cyclohexan-1-ol is also used in chemical synthesis for the creation of related compounds or analogs that may possess enhanced or modified biological activities. This can lead to the discovery of new drugs with improved efficacy or reduced side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 6318-03-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,1 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6318-03:
(6*6)+(5*3)+(4*1)+(3*8)+(2*0)+(1*3)=82
82 % 10 = 2
So 6318-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H19N5O/c1-17(2)12-11-13(15-7-14-12)18(8-16-11)9-5-3-4-6-10(9)19/h7-10,19H,3-6H2,1-2H3/t9-,10-/m0/s1
